Other Solvents
Filtered Search Results
Dimethyl-d6 sulfate, for NMR, 99+ atom % D
CAS: 15199-43-6 Molecular Formula: C2H6O4S Molecular Weight (g/mol): 132.163 MDL Number: MFCD00044221 InChI Key: VAYGXNSJCAHWJZ-WFGJKAKNSA-N Synonym: dimethyl sulfate-d6,di 2h3 methyl sulphate,dimethylsulfate-d6,methan-d3-ol, sulfate 2:1,dimethyl sulfate d6,bis 2h3 methyl sulfate,methyl sulfate-d6,bis trideuteriomethyl sulfate,bis 2 h? methyl sulfate,dimethyl sulfate-d6, 99 atom % d PubChem CID: 84832 IUPAC Name: bis(trideuteriomethyl) sulfate SMILES: COS(=O)(=O)OC
| PubChem CID | 84832 |
|---|---|
| CAS | 15199-43-6 |
| Molecular Weight (g/mol) | 132.163 |
| MDL Number | MFCD00044221 |
| SMILES | COS(=O)(=O)OC |
| Synonym | dimethyl sulfate-d6,di 2h3 methyl sulphate,dimethylsulfate-d6,methan-d3-ol, sulfate 2:1,dimethyl sulfate d6,bis 2h3 methyl sulfate,methyl sulfate-d6,bis trideuteriomethyl sulfate,bis 2 h? methyl sulfate,dimethyl sulfate-d6, 99 atom % d |
| IUPAC Name | bis(trideuteriomethyl) sulfate |
| InChI Key | VAYGXNSJCAHWJZ-WFGJKAKNSA-N |
| Molecular Formula | C2H6O4S |
Dichloromethane-d2, 100% (Isotopic), Thermo Scientific Chemicals
CAS: 1665-00-5 Molecular Formula: CH2Cl2 Molecular Weight (g/mol): 86.939 MDL Number: MFCD00000882 InChI Key: YMWUJEATGCHHMB-DICFDUPASA-N Synonym: dichloromethane-d2,methylene chloride-d2,dichloro 2h2 methane,methane-d2, dichloro,cd2cl2,deuterated dichloromethane,dichloro dideuterio methane,dideuteromethylene chloride,dichloromethane-d2, 99.9 atom % d,dichloromethane-d', 99.96 atom % d PubChem CID: 160586 IUPAC Name: dichloro(dideuterio)methane SMILES: C(Cl)Cl
| PubChem CID | 160586 |
|---|---|
| CAS | 1665-00-5 |
| Molecular Weight (g/mol) | 86.939 |
| MDL Number | MFCD00000882 |
| SMILES | C(Cl)Cl |
| Synonym | dichloromethane-d2,methylene chloride-d2,dichloro 2h2 methane,methane-d2, dichloro,cd2cl2,deuterated dichloromethane,dichloro dideuterio methane,dideuteromethylene chloride,dichloromethane-d2, 99.9 atom % d,dichloromethane-d', 99.96 atom % d |
| IUPAC Name | dichloro(dideuterio)methane |
| InChI Key | YMWUJEATGCHHMB-DICFDUPASA-N |
| Molecular Formula | CH2Cl2 |
1,2-Dibromoethane-d{4}, 99%(Isotopic)
CAS: 22581-63-1 Molecular Formula: C2H4Br2 Molecular Weight (g/mol): 191.886 MDL Number: MFCD00037499 InChI Key: PAAZPARNPHGIKF-LNLMKGTHSA-N Synonym: 1,2-dibromoethane-d4,1,2-dibromo-1,1,2,2-2h4 ethane,dibromo 2 h? ethane,dibromoethane-d4,ethane-d4, 1,2-dibromo,ethylene-d4 dibromide,2h4-edb,tetradeutero-1,2-dibromoethane,1,2-dibromoethane-d4, 99 atom % d,1,2-dibromoethane-d4 99.0 atom % d PubChem CID: 123404 IUPAC Name: 1,2-dibromo-1,1,2,2-tetradeuterioethane SMILES: C(CBr)Br
| PubChem CID | 123404 |
|---|---|
| CAS | 22581-63-1 |
| Molecular Weight (g/mol) | 191.886 |
| MDL Number | MFCD00037499 |
| SMILES | C(CBr)Br |
| Synonym | 1,2-dibromoethane-d4,1,2-dibromo-1,1,2,2-2h4 ethane,dibromo 2 h? ethane,dibromoethane-d4,ethane-d4, 1,2-dibromo,ethylene-d4 dibromide,2h4-edb,tetradeutero-1,2-dibromoethane,1,2-dibromoethane-d4, 99 atom % d,1,2-dibromoethane-d4 99.0 atom % d |
| IUPAC Name | 1,2-dibromo-1,1,2,2-tetradeuterioethane |
| InChI Key | PAAZPARNPHGIKF-LNLMKGTHSA-N |
| Molecular Formula | C2H4Br2 |
Dimethyl sulfoxide - D6, w/TMS(0.03vol.%), deuteratn. deg. min. 99.8% for NMR MagniSolv™, MilliporeSigma™
CAS: 2206-27-1 Molecular Formula: C2H6OS Molecular Weight (g/mol): 84.17 MDL Number: MFCD00002090 InChI Key: IAZDPXIOMUYVGZ-WFGJKAKNSA-N Synonym: dimethyl sulfoxide-d6,dmso-d6,dimethylsulfoxide-d6,deuterated dmso,methane-d3,sulfinylbis-9ci,methane-d3, sulfinylbis,hexadeuterodimethyl sulfoxide,methane-d3-, sulfinylbis,methanesulfinylmethyl hydrogen,dimethyl-d6 sulfoxide PubChem CID: 75151 IUPAC Name: (²H₃)methanesulfinyl(²H₃)methane SMILES: [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H]
| PubChem CID | 75151 |
|---|---|
| CAS | 2206-27-1 |
| Molecular Weight (g/mol) | 84.17 |
| MDL Number | MFCD00002090 |
| SMILES | [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] |
| Synonym | dimethyl sulfoxide-d6,dmso-d6,dimethylsulfoxide-d6,deuterated dmso,methane-d3,sulfinylbis-9ci,methane-d3, sulfinylbis,hexadeuterodimethyl sulfoxide,methane-d3-, sulfinylbis,methanesulfinylmethyl hydrogen,dimethyl-d6 sulfoxide |
| IUPAC Name | (²H₃)methanesulfinyl(²H₃)methane |
| InChI Key | IAZDPXIOMUYVGZ-WFGJKAKNSA-N |
| Molecular Formula | C2H6OS |
1,1,2,2-Tetrachloroethane-d{2}, 99.5% (Isotopic)
CAS: 33685-54-0 Molecular Formula: C2H2Cl4 Molecular Weight (g/mol): 169.85 MDL Number: MFCD00037672 InChI Key: QPFMBZIOSGYJDE-QDNHWIQGSA-N Synonym: 1,1,2,2-tetrachloroethane-d2,1,2-dideutero-1,1,2,2-tetrachloroethane,tetrachloro 2 h? ethane,1,1,2,2-tetrachloroethane-d2 tce-d2,ethane-d2, 1,1,2,2-tetrachloro,ethane-1,2-d2, 1,1,2,2-tetrachloro,1,1,2,2-tetrachloro-1,2-2h2 ethane,de87d,1,1,2,2-tetrachloroethane-d2 >99.50 atom % d,1,1,2,2-tetrachloroethane-d2, ≥99.5 atom % d PubChem CID: 118531 IUPAC Name: 1,1,2,2-tetrachloro-1,2-dideuterioethane SMILES: C(C(Cl)Cl)(Cl)Cl
| PubChem CID | 118531 |
|---|---|
| CAS | 33685-54-0 |
| Molecular Weight (g/mol) | 169.85 |
| MDL Number | MFCD00037672 |
| SMILES | C(C(Cl)Cl)(Cl)Cl |
| Synonym | 1,1,2,2-tetrachloroethane-d2,1,2-dideutero-1,1,2,2-tetrachloroethane,tetrachloro 2 h? ethane,1,1,2,2-tetrachloroethane-d2 tce-d2,ethane-d2, 1,1,2,2-tetrachloro,ethane-1,2-d2, 1,1,2,2-tetrachloro,1,1,2,2-tetrachloro-1,2-2h2 ethane,de87d,1,1,2,2-tetrachloroethane-d2 >99.50 atom % d,1,1,2,2-tetrachloroethane-d2, ≥99.5 atom % d |
| IUPAC Name | 1,1,2,2-tetrachloro-1,2-dideuterioethane |
| InChI Key | QPFMBZIOSGYJDE-QDNHWIQGSA-N |
| Molecular Formula | C2H2Cl4 |
Nitrobenzene-d5, for NMR, 99 atom % D
CAS: 4165-60-0 Molecular Formula: C6H5NO2 Molecular Weight (g/mol): 128.14 MDL Number: MFCD00044415 InChI Key: LQNUZADURLCDLV-RALIUCGRSA-N Synonym: nitrobenzene-d5,benzene-d5, nitro,nitrobenzene d5,benzene-d5-, nitro,1-nitro 2 h? benzene,nitrobenzene-d5, 99.5 atom % d,nitro 2h5 benzene,1-nitro 2h5 benzene,2h5 benzene, nitro,nitrobenzene-d5, analytical standard PubChem CID: 123210 IUPAC Name: 1,2,3,4,5-pentadeuterio-6-nitrobenzene SMILES: [2H]C1=C([2H])C([2H])=C(C([2H])=C1[2H])[N+]([O-])=O
| PubChem CID | 123210 |
|---|---|
| CAS | 4165-60-0 |
| Molecular Weight (g/mol) | 128.14 |
| MDL Number | MFCD00044415 |
| SMILES | [2H]C1=C([2H])C([2H])=C(C([2H])=C1[2H])[N+]([O-])=O |
| Synonym | nitrobenzene-d5,benzene-d5, nitro,nitrobenzene d5,benzene-d5-, nitro,1-nitro 2 h? benzene,nitrobenzene-d5, 99.5 atom % d,nitro 2h5 benzene,1-nitro 2h5 benzene,2h5 benzene, nitro,nitrobenzene-d5, analytical standard |
| IUPAC Name | 1,2,3,4,5-pentadeuterio-6-nitrobenzene |
| InChI Key | LQNUZADURLCDLV-RALIUCGRSA-N |
| Molecular Formula | C6H5NO2 |
Acetic-d3 acid-d, for NMR, 99.5 atom % D
CAS: 1186-52-3 Molecular Formula: C2H4O2 Molecular Weight (g/mol): 64.08 MDL Number: MFCD00051051 InChI Key: QTBSBXVTEAMEQO-GUEYOVJQSA-N Synonym: acetic acid-d4,acetic-d3 acid-d,2h3 acetic 2h acid,tetradeuteroacetic acid,2 h? ethan 2 h oic acid,acetic acid d4,2h4 acetic acid,cd3cood,acetic acid d,acetic acid-d4, 99.5 atom % d PubChem CID: 2723903 IUPAC Name: deuterio 2,2,2-trideuterioacetate SMILES: [2H]OC(=O)C([2H])([2H])[2H]
| PubChem CID | 2723903 |
|---|---|
| CAS | 1186-52-3 |
| Molecular Weight (g/mol) | 64.08 |
| MDL Number | MFCD00051051 |
| SMILES | [2H]OC(=O)C([2H])([2H])[2H] |
| Synonym | acetic acid-d4,acetic-d3 acid-d,2h3 acetic 2h acid,tetradeuteroacetic acid,2 h? ethan 2 h oic acid,acetic acid d4,2h4 acetic acid,cd3cood,acetic acid d,acetic acid-d4, 99.5 atom % d |
| IUPAC Name | deuterio 2,2,2-trideuterioacetate |
| InChI Key | QTBSBXVTEAMEQO-GUEYOVJQSA-N |
| Molecular Formula | C2H4O2 |
Ethylene glycol-d{6}, 98% (Isotopic)
CAS: 15054-86-1 Molecular Formula: C2H6O2 Molecular Weight (g/mol): 68.11 MDL Number: MFCD00078666 InChI Key: LYCAIKOWRPUZTN-UFSLNRCZSA-N Synonym: ethylene glycol-d6,1,1,2,2-2h4 ethane-1,2-2h2 diol,1,2-ethane-1,1,2,2-d4-diol-d2,2 h? ethane-1,2-di 2 h ol,ethylen-d4 glycol-d2,ethylene glycol d6,ethylene glycol-d6, 98 atom % d,ethylene glycol-d6 >99.0 atom % d PubChem CID: 2733139 IUPAC Name: (²H₄)ethane-1,2-di(²H)ol SMILES: [2H]OC([2H])([2H])C([2H])([2H])O[2H]
| PubChem CID | 2733139 |
|---|---|
| CAS | 15054-86-1 |
| Molecular Weight (g/mol) | 68.11 |
| MDL Number | MFCD00078666 |
| SMILES | [2H]OC([2H])([2H])C([2H])([2H])O[2H] |
| Synonym | ethylene glycol-d6,1,1,2,2-2h4 ethane-1,2-2h2 diol,1,2-ethane-1,1,2,2-d4-diol-d2,2 h? ethane-1,2-di 2 h ol,ethylen-d4 glycol-d2,ethylene glycol d6,ethylene glycol-d6, 98 atom % d,ethylene glycol-d6 >99.0 atom % d |
| IUPAC Name | (²H₄)ethane-1,2-di(²H)ol |
| InChI Key | LYCAIKOWRPUZTN-UFSLNRCZSA-N |
| Molecular Formula | C2H6O2 |
Dimethyl sulfoxide - D6, w/TMS (0.1vol.%), deuteratn. deg. min.99.9% for NMR MagniSolv™, MilliporeSigma™
CAS: 2206-27-1 Molecular Formula: C2H6OS Molecular Weight (g/mol): 84.17 MDL Number: MFCD00002090 InChI Key: IAZDPXIOMUYVGZ-WFGJKAKNSA-N Synonym: dimethyl sulfoxide-d6,dmso-d6,dimethylsulfoxide-d6,deuterated dmso,methane-d3,sulfinylbis-9ci,methane-d3, sulfinylbis,hexadeuterodimethyl sulfoxide,methane-d3-, sulfinylbis,methanesulfinylmethyl hydrogen,dimethyl-d6 sulfoxide PubChem CID: 75151 IUPAC Name: (²H₃)methanesulfinyl(²H₃)methane SMILES: [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H]
| PubChem CID | 75151 |
|---|---|
| CAS | 2206-27-1 |
| Molecular Weight (g/mol) | 84.17 |
| MDL Number | MFCD00002090 |
| SMILES | [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] |
| Synonym | dimethyl sulfoxide-d6,dmso-d6,dimethylsulfoxide-d6,deuterated dmso,methane-d3,sulfinylbis-9ci,methane-d3, sulfinylbis,hexadeuterodimethyl sulfoxide,methane-d3-, sulfinylbis,methanesulfinylmethyl hydrogen,dimethyl-d6 sulfoxide |
| IUPAC Name | (²H₃)methanesulfinyl(²H₃)methane |
| InChI Key | IAZDPXIOMUYVGZ-WFGJKAKNSA-N |
| Molecular Formula | C2H6OS |
Methanol-d{4}, 99.8% (Isotopic)
CAS: 811-98-3 Molecular Formula: CH4O Molecular Weight (g/mol): 36.066 MDL Number: MFCD00044637 InChI Key: OKKJLVBELUTLKV-MZCSYVLQSA-N Synonym: methanol-d4,perdeuteromethanol,tetradeuteromethanol,methan-d3-ol-d,2h4 methanol,methyl alcohol-d4,cd3od,methyl-d3 alcohol-d,trideuterio deuteriooxy methane,methanol-d4, 99.8 atom % d PubChem CID: 71568 IUPAC Name: trideuterio(deuteriooxy)methane SMILES: CO
| PubChem CID | 71568 |
|---|---|
| CAS | 811-98-3 |
| Molecular Weight (g/mol) | 36.066 |
| MDL Number | MFCD00044637 |
| SMILES | CO |
| Synonym | methanol-d4,perdeuteromethanol,tetradeuteromethanol,methan-d3-ol-d,2h4 methanol,methyl alcohol-d4,cd3od,methyl-d3 alcohol-d,trideuterio deuteriooxy methane,methanol-d4, 99.8 atom % d |
| IUPAC Name | trideuterio(deuteriooxy)methane |
| InChI Key | OKKJLVBELUTLKV-MZCSYVLQSA-N |
| Molecular Formula | CH4O |
Cyclohexane-d{12}, 99.5%(Isotopic)
CAS: 1735-17-7 Molecular Formula: C6H12 Molecular Weight (g/mol): 96.24 MDL Number: MFCD00044212 InChI Key: XDTMQSROBMDMFD-LBTWDOQPSA-N Synonym: cyclohexane-d12,2h12 cyclohexane,cyclohexane d,cyclohexane, d12,2 h?? cyclohexane,cyclohexane-d12, ≥99.6 atom % d,cyclohexane #,cyclohexane-d12, 99.5 atom % d PubChem CID: 123129 SMILES: [2H]C1([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C1([2H])[2H]
| PubChem CID | 123129 |
|---|---|
| CAS | 1735-17-7 |
| Molecular Weight (g/mol) | 96.24 |
| MDL Number | MFCD00044212 |
| SMILES | [2H]C1([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C1([2H])[2H] |
| Synonym | cyclohexane-d12,2h12 cyclohexane,cyclohexane d,cyclohexane, d12,2 h?? cyclohexane,cyclohexane-d12, ≥99.6 atom % d,cyclohexane #,cyclohexane-d12, 99.5 atom % d |
| InChI Key | XDTMQSROBMDMFD-LBTWDOQPSA-N |
| Molecular Formula | C6H12 |
Naphthalene-d8, for NMR, 98+ atom % D
CAS: 1146-65-2 Molecular Formula: C10H8 Molecular Weight (g/mol): 136.22 MDL Number: MFCD00001743 InChI Key: UFWIBTONFRDIAS-PGRXLJNUSA-N Synonym: naphthalene-d8,2h8 naphthalene,perdeuteronaphthalene,naphthalene d8,perdeuterated naphthalene,2 h? naphthalene,naphthalene-d8, analytical standard,naphthalene-d8 >98.0 atom % d,naphthalene d8 10 microg/ml in cyclohexane PubChem CID: 92148 IUPAC Name: 1,2,3,4,5,6,7,8-octadeuterionaphthalene SMILES: [2H]C1=C([2H])C2=C([2H])C([2H])=C([2H])C([2H])=C2C([2H])=C1[2H]
| PubChem CID | 92148 |
|---|---|
| CAS | 1146-65-2 |
| Molecular Weight (g/mol) | 136.22 |
| MDL Number | MFCD00001743 |
| SMILES | [2H]C1=C([2H])C2=C([2H])C([2H])=C([2H])C([2H])=C2C([2H])=C1[2H] |
| Synonym | naphthalene-d8,2h8 naphthalene,perdeuteronaphthalene,naphthalene d8,perdeuterated naphthalene,2 h? naphthalene,naphthalene-d8, analytical standard,naphthalene-d8 >98.0 atom % d,naphthalene d8 10 microg/ml in cyclohexane |
| IUPAC Name | 1,2,3,4,5,6,7,8-octadeuterionaphthalene |
| InChI Key | UFWIBTONFRDIAS-PGRXLJNUSA-N |
| Molecular Formula | C10H8 |
n-Hexane-d{14}, 99%(Isotopic)
CAS: 21666-38-6 Molecular Formula: C6H14 Molecular Weight (g/mol): 100.26 MDL Number: MFCD00037562 InChI Key: VLKZOEOYAKHREP-ZLKPZJALSA-N Synonym: hexane-d14,tetradecadeuterohexane,n-hexane-d 14,2h14 hexane,2 h?? hexane,hexane-d14, 99 atom % d PubChem CID: 140854 IUPAC Name: 1,1,1,2,2,3,3,4,4,5,5,6,6,6-tetradecadeuteriohexane SMILES: [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H]
| PubChem CID | 140854 |
|---|---|
| CAS | 21666-38-6 |
| Molecular Weight (g/mol) | 100.26 |
| MDL Number | MFCD00037562 |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
| Synonym | hexane-d14,tetradecadeuterohexane,n-hexane-d 14,2h14 hexane,2 h?? hexane,hexane-d14, 99 atom % d |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,6-tetradecadeuteriohexane |
| InChI Key | VLKZOEOYAKHREP-ZLKPZJALSA-N |
| Molecular Formula | C6H14 |
n-Hexane-d14, for NMR, 99+ atom % D
CAS: 21666-38-6 Molecular Formula: C6H14 Molecular Weight (g/mol): 100.26 MDL Number: MFCD00037562 InChI Key: VLKZOEOYAKHREP-ZLKPZJALSA-N Synonym: hexane-d14,tetradecadeuterohexane,n-hexane-d 14,2h14 hexane,2 h?? hexane,hexane-d14, 99 atom % d PubChem CID: 140854 IUPAC Name: 1,1,1,2,2,3,3,4,4,5,5,6,6,6-tetradecadeuteriohexane SMILES: [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H]
| PubChem CID | 140854 |
|---|---|
| CAS | 21666-38-6 |
| Molecular Weight (g/mol) | 100.26 |
| MDL Number | MFCD00037562 |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
| Synonym | hexane-d14,tetradecadeuterohexane,n-hexane-d 14,2h14 hexane,2 h?? hexane,hexane-d14, 99 atom % d |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,6-tetradecadeuteriohexane |
| InChI Key | VLKZOEOYAKHREP-ZLKPZJALSA-N |
| Molecular Formula | C6H14 |
TraceCERT™ Chloroform, 5000 μg/mL, Certified Reference Material, MilliporeSigma™ Supelco™
This certified reference material (CRM) is produced and certified in accordance with ISO/IEC 17025 and ISO 17034. This CRM is traceable to the SI through a primary reference material from a NMI. Certified content incl. uncertainty and expiry date are stated on the enclosed certificate.